About cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane
cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane (PubChem CID 145147966) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane |
| PubChem CID | 145147966 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane |
| SMILES | CC.CC1=CCN(C(=O)OCC#N)CC1 |
| InChI | InChI=1S/C9H12N2O2.C2H6/c1-8-2-5-11(6-3-8)9(12)13-7-4-10;1-2/h2H,3,5-7H2,1H3;1-2H3 |
| InChIKey | WNTKHRMSPBWOFQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane?
The IUPAC name of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane (CID 145147966) is cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane.
What is the SMILES notation for cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane?
The canonical SMILES for cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane is CC.CC1=CCN(C(=O)OCC#N)CC1.
What is the InChIKey of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane?
The InChIKey is WNTKHRMSPBWOFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.C2H6/c1-8-2-5-11(6-3-8)9(12)13-7-4-10;1-2/h2H,3,5-7H2,1H3;1-2H3.
What are the key properties of cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane?
cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane has a molecular weight of 210.28 g/mol, XLogP of 2.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl 4-methyl-3,6-dihydro-2H-pyridine-1-carboxylate;ethane is sourced from PubChem (CID 145147966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).