C15H17F2NO2 — CID 145148162
5-[3-(difluoromethoxy)phenyl]-1,2,3-trimethylpyridin-2-ol (PubChem CID 145148162) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 5-[3-(difluoromethoxy)phenyl]-1,2,3-trimethylpyridin-2-ol.
| Compound Name | 5-[3-(difluoromethoxy)phenyl]-1,2,3-trimethylpyridin-2-ol |
|---|---|
| PubChem CID | 145148162 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-[3-(difluoromethoxy)phenyl]-1,2,3-trimethylpyridin-2-ol |
| SMILES | CC1=CC(c2cccc(OC(F)F)c2)=CN(C)C1(C)O |
| InChI | InChI=1S/C15H17F2NO2/c1-10-7-12(9-18(3)15(10,2)19)11-5-4-6-13(8-11)20-14(16)17/h4-9,14,19H,1-3H3 |
| InChIKey | ZDGVGBRLBSNMOO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |