About 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane
5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane (PubChem CID 145148277) has the molecular formula C20H27N3O
and a molecular weight of 325.46 g/mol. Its IUPAC name is 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane.
Molecular Properties
| Compound Name | 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane |
| PubChem CID | 145148277 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane |
| SMILES | CC.Cn1cc(-c2ccc(CN3CC4CC3CN4)cc2)ccc1=O |
| InChI | InChI=1S/C18H21N3O.C2H6/c1-20-11-15(6-7-18(20)22)14-4-2-13(3-5-14)10-21-12-16-8-17(21)9-19-16;1-2/h2-7,11,16-17,19H,8-10,12H2,1H3;1-2H3 |
| InChIKey | GTIAXOPHCKIIPC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane?
The IUPAC name of 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane (CID 145148277) is 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane.
What is the SMILES notation for 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane?
The canonical SMILES for 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane is CC.Cn1cc(-c2ccc(CN3CC4CC3CN4)cc2)ccc1=O.
What is the InChIKey of 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane?
The InChIKey is GTIAXOPHCKIIPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O.C2H6/c1-20-11-15(6-7-18(20)22)14-4-2-13(3-5-14)10-21-12-16-8-17(21)9-19-16;1-2/h2-7,11,16-17,19H,8-10,12H2,1H3;1-2H3.
What are the key properties of 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane?
5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane has a molecular weight of 325.46 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2,5-diazabicyclo[2.2.1]heptan-2-ylmethyl)phenyl]-1-methylpyridin-2-one;ethane is sourced from PubChem (CID 145148277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).