C24H21BN2O2 — CID 145148571
[9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-pyridin-3-ylcarbazol-2-yl]boronic acid (PubChem CID 145148571) has the molecular formula C24H21BN2O2 and a molecular weight of 380.26 g/mol. Its IUPAC name is [9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-pyridin-3-ylcarbazol-2-yl]boronic acid.
| Compound Name | [9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-pyridin-3-ylcarbazol-2-yl]boronic acid |
|---|---|
| PubChem CID | 145148571 |
| Molecular Formula | C24H21BN2O2 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-6-pyridin-3-ylcarbazol-2-yl]boronic acid |
| SMILES | C=C/C=C\C(=C/C)n1c2ccc(-c3cccnc3)cc2c2ccc(B(O)O)cc21 |
| InChI | InChI=1S/C24H21BN2O2/c1-3-5-8-20(4-2)27-23-12-9-17(18-7-6-13-26-16-18)14-22(23)21-11-10-19(25(28)29)15-24(21)27/h3-16,28-29H,1H2,2H3/b8-5-,20-4+ |
| InChIKey | XHVBLTZLDSHCNM-BGSINUBSSA-N |
| XLogP | 4.14 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|