About ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine
ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine (PubChem CID 145149545) has the molecular formula C10H16F3N
and a molecular weight of 207.24 g/mol. Its IUPAC name is ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine.
Molecular Properties
| Compound Name | ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine |
| PubChem CID | 145149545 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine |
| SMILES | C=C/C(CC(F)(F)F)=N\C=C/C.CC |
| InChI | InChI=1S/C8H10F3N.C2H6/c1-3-5-12-7(4-2)6-8(9,10)11;1-2/h3-5H,2,6H2,1H3;1-2H3/b5-3-,12-7+; |
| InChIKey | NPGIPRWIIMIBAD-SQZNJMCVSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine?
The IUPAC name of ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine (CID 145149545) is ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine.
What is the SMILES notation for ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine?
The canonical SMILES for ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine is C=C/C(CC(F)(F)F)=N\C=C/C.CC.
What is the InChIKey of ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine?
The InChIKey is NPGIPRWIIMIBAD-SQZNJMCVSA-N. The full InChI is InChI=1S/C8H10F3N.C2H6/c1-3-5-12-7(4-2)6-8(9,10)11;1-2/h3-5H,2,6H2,1H3;1-2H3/b5-3-,12-7+;.
What are the key properties of ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine?
ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine has a molecular weight of 207.24 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5,5,5-trifluoro-N-[(Z)-prop-1-enyl]pent-1-en-3-imine is sourced from PubChem (CID 145149545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).