About (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine
(3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine (PubChem CID 145149819) has the molecular formula C12H28N2S
and a molecular weight of 232.44 g/mol. Its IUPAC name is (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine.
Molecular Properties
| Compound Name | (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine |
| PubChem CID | 145149819 |
| Molecular Formula | C12H28N2S |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine |
| SMILES | CC/C=[S@](\CCC)N[C@@H](CCC)CCN |
| InChI | InChI=1S/C12H28N2S/c1-4-7-12(8-9-13)14-15(10-5-2)11-6-3/h10,12,14H,4-9,11,13H2,1-3H3/t12-,15+/m0/s1 |
| InChIKey | ARDCMSQGZRVXPP-SWLSCSKDSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine?
The IUPAC name of (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine (CID 145149819) is (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine.
What is the SMILES notation for (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine?
The canonical SMILES for (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine is CC/C=[S@](\CCC)N[C@@H](CCC)CCN.
What is the InChIKey of (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine?
The InChIKey is ARDCMSQGZRVXPP-SWLSCSKDSA-N. The full InChI is InChI=1S/C12H28N2S/c1-4-7-12(8-9-13)14-15(10-5-2)11-6-3/h10,12,14H,4-9,11,13H2,1-3H3/t12-,15+/m0/s1.
What are the key properties of (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine?
(3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine has a molecular weight of 232.44 g/mol, XLogP of 2.90, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-N-[(E)-propyl(propylidene)-λ4-sulfanyl]hexane-1,3-diamine is sourced from PubChem (CID 145149819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).