About N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate
N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate (PubChem CID 145150312) has the molecular formula C16H30N4O4
and a molecular weight of 342.44 g/mol. Its IUPAC name is N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate.
Molecular Properties
| Compound Name | N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate |
| PubChem CID | 145150312 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate |
| SMILES | C/N=C(\N)C1CCC(C)N1C(=O)CC1CCOCC1.COC(N)=O |
| InChI | InChI=1S/C14H25N3O2.C2H5NO2/c1-10-3-4-12(14(15)16-2)17(10)13(18)9-11-5-7-19-8-6-11;1-5-2(3)4/h10-12H,3-9H2,1-2H3,(H2,15,16);1H3,(H2,3,4) |
| InChIKey | RIHVLBURCGMBEG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate?
The IUPAC name of N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate (CID 145150312) is N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate.
What is the SMILES notation for N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate?
The canonical SMILES for N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate is C/N=C(\N)C1CCC(C)N1C(=O)CC1CCOCC1.COC(N)=O.
What is the InChIKey of N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate?
The InChIKey is RIHVLBURCGMBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O2.C2H5NO2/c1-10-3-4-12(14(15)16-2)17(10)13(18)9-11-5-7-19-8-6-11;1-5-2(3)4/h10-12H,3-9H2,1-2H3,(H2,15,16);1H3,(H2,3,4).
What are the key properties of N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate?
N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate has a molecular weight of 342.44 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N',5-dimethyl-1-[2-(oxan-4-yl)acetyl]pyrrolidine-2-carboximidamide;methyl carbamate is sourced from PubChem (CID 145150312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).