C9H10INO — CID 145151129
5-iodo-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 145151129) has the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. Its IUPAC name is 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine.
| Compound Name | 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine |
|---|---|
| PubChem CID | 145151129 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | IN1CCCOc2ccccc21 |
| InChI | InChI=1S/C9H10INO/c10-11-6-3-7-12-9-5-2-1-4-8(9)11/h1-2,4-5H,3,6-7H2 |
| InChIKey | VZJDNJVXPAUVPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|