About 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine
5-iodo-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 145151129) has the molecular formula C9H10INO
and a molecular weight of 275.09 g/mol. Its IUPAC name is 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine.
Molecular Properties
| Compound Name | 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine |
| PubChem CID | 145151129 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | IN1CCCOc2ccccc21 |
| InChI | InChI=1S/C9H10INO/c10-11-6-3-7-12-9-5-2-1-4-8(9)11/h1-2,4-5H,3,6-7H2 |
| InChIKey | VZJDNJVXPAUVPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine?
The IUPAC name of 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine (CID 145151129) is 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine.
What is the SMILES notation for 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine?
The canonical SMILES for 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine is IN1CCCOc2ccccc21.
What is the InChIKey of 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine?
The InChIKey is VZJDNJVXPAUVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10INO/c10-11-6-3-7-12-9-5-2-1-4-8(9)11/h1-2,4-5H,3,6-7H2.
What are the key properties of 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine?
5-iodo-3,4-dihydro-2H-1,5-benzoxazepine has a molecular weight of 275.09 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-3,4-dihydro-2H-1,5-benzoxazepine is sourced from PubChem (CID 145151129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).