About 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole
5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole (PubChem CID 145152080) has the molecular formula C11H12N4
and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole.
Molecular Properties
| Compound Name | 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole |
| PubChem CID | 145152080 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole |
| SMILES | C=C/C=C\C(=C)C(=C)n1nnnc1C=C |
| InChI | InChI=1S/C11H12N4/c1-5-7-8-9(3)10(4)15-11(6-2)12-13-14-15/h5-8H,1-4H2/b8-7- |
| InChIKey | TUFQGLDHPQEHMJ-FPLPWBNLSA-N |
| XLogP | 2.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole?
The IUPAC name of 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole (CID 145152080) is 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole.
What is the SMILES notation for 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole?
The canonical SMILES for 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole is C=C/C=C\C(=C)C(=C)n1nnnc1C=C.
What is the InChIKey of 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole?
The InChIKey is TUFQGLDHPQEHMJ-FPLPWBNLSA-N. The full InChI is InChI=1S/C11H12N4/c1-5-7-8-9(3)10(4)15-11(6-2)12-13-14-15/h5-8H,1-4H2/b8-7-.
What are the key properties of 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole?
5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole has a molecular weight of 200.24 g/mol, XLogP of 2.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1-[(4Z)-3-methylidenehepta-1,4,6-trien-2-yl]tetrazole is sourced from PubChem (CID 145152080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).