About (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane
(4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane (PubChem CID 145152735) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane.
Molecular Properties
| Compound Name | (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane |
| PubChem CID | 145152735 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane |
| SMILES | C=C/C=c1\c(=C/C(C)C)c(C)nn1C.CC |
| InChI | InChI=1S/C12H18N2.C2H6/c1-6-7-12-11(8-9(2)3)10(4)13-14(12)5;1-2/h6-9H,1H2,2-5H3;1-2H3/b11-8-,12-7+; |
| InChIKey | XKCAKDRQRNUIGF-TZMARPLHSA-N |
| XLogP | 2.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane?
The IUPAC name of (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane (CID 145152735) is (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane.
What is the SMILES notation for (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane?
The canonical SMILES for (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane is C=C/C=c1\c(=C/C(C)C)c(C)nn1C.CC.
What is the InChIKey of (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane?
The InChIKey is XKCAKDRQRNUIGF-TZMARPLHSA-N. The full InChI is InChI=1S/C12H18N2.C2H6/c1-6-7-12-11(8-9(2)3)10(4)13-14(12)5;1-2/h6-9H,1H2,2-5H3;1-2H3/b11-8-,12-7+;.
What are the key properties of (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane?
(4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane has a molecular weight of 220.36 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-1,3-dimethyl-4-(2-methylpropylidene)-5-prop-2-enylidenepyrazole;ethane is sourced from PubChem (CID 145152735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).