C12H24N2 — CID 145153561
ethane;methanimine;(3E,5Z)-3-methylocta-3,5,7-trien-4-amine (PubChem CID 145153561) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is ethane;methanimine;(3E,5Z)-3-methylocta-3,5,7-trien-4-amine.
| Compound Name | ethane;methanimine;(3E,5Z)-3-methylocta-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 145153561 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | ethane;methanimine;(3E,5Z)-3-methylocta-3,5,7-trien-4-amine |
| SMILES | C=C/C=C\C(N)=C(\C)CC.CC.[H]N=C |
| InChI | InChI=1S/C9H15N.C2H6.CH3N/c1-4-6-7-9(10)8(3)5-2;2*1-2/h4,6-7H,1,5,10H2,2-3H3;1-2H3;2H,1H2/b7-6-,9-8+;; |
| InChIKey | NKQBOGQRQSSBAV-YDFFBLRRSA-N |
| XLogP | 3.66 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|