C14H16F3NO2S — CID 145153687
1-(2,2,3-trifluoro-1-hydroxy-7-sulfanyl-1,3-dihydroinden-4-yl)piperidin-3-ol (PubChem CID 145153687) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-(2,2,3-trifluoro-1-hydroxy-7-sulfanyl-1,3-dihydroinden-4-yl)piperidin-3-ol.
| Compound Name | 1-(2,2,3-trifluoro-1-hydroxy-7-sulfanyl-1,3-dihydroinden-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 145153687 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 1-(2,2,3-trifluoro-1-hydroxy-7-sulfanyl-1,3-dihydroinden-4-yl)piperidin-3-ol |
| SMILES | OC1CCCN(c2ccc(S)c3c2C(F)C(F)(F)C3O)C1 |
| InChI | InChI=1S/C14H16F3NO2S/c15-12-10-8(18-5-1-2-7(19)6-18)3-4-9(21)11(10)13(20)14(12,16)17/h3-4,7,12-13,19-21H,1-2,5-6H2 |
| InChIKey | CPUCDDZKXZZGRL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|