About 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane
7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane (PubChem CID 145153891) has the molecular formula C14H17ClOS
and a molecular weight of 268.81 g/mol. Its IUPAC name is 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane.
Molecular Properties
| Compound Name | 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane |
| PubChem CID | 145153891 |
| Molecular Formula | C14H17ClOS |
| Molecular Weight | 268.81 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane |
| SMILES | CC.CC1OCCc2c1sc1cc(Cl)ccc21 |
| InChI | InChI=1S/C12H11ClOS.C2H6/c1-7-12-10(4-5-14-7)9-3-2-8(13)6-11(9)15-12;1-2/h2-3,6-7H,4-5H2,1H3;1-2H3 |
| InChIKey | HRTOXKMPUXXFQK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane?
The IUPAC name of 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane (CID 145153891) is 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane.
What is the SMILES notation for 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane?
The canonical SMILES for 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane is CC.CC1OCCc2c1sc1cc(Cl)ccc21.
What is the InChIKey of 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane?
The InChIKey is HRTOXKMPUXXFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClOS.C2H6/c1-7-12-10(4-5-14-7)9-3-2-8(13)6-11(9)15-12;1-2/h2-3,6-7H,4-5H2,1H3;1-2H3.
What are the key properties of 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane?
7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane has a molecular weight of 268.81 g/mol, XLogP of 5.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-methyl-3,4-dihydro-1H-[1]benzothiolo[2,3-c]pyran;ethane is sourced from PubChem (CID 145153891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).