C28H33ClFN7O2 — CID 145154341
2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine (PubChem CID 145154341) has the molecular formula C28H33ClFN7O2 and a molecular weight of 554.07 g/mol. Its IUPAC name is 2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine |
|---|---|
| PubChem CID | 145154341 |
| Molecular Formula | C28H33ClFN7O2 |
| Molecular Weight | 554.07 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[3-[[4-[6-[5-(4-aminopentyl)-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine |
| SMILES | CC(N)CCCc1cc(Cl)c(F)c(-c2cc3cn(-c4ccc(COCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C28H33ClFN7O2/c1-17(31)4-2-5-19-12-22(25(30)23(29)13-19)24-14-20-15-37(28(38)36-26(20)35-24)21-8-6-18(7-9-21)16-39-11-3-10-34-27(32)33/h6-9,12-15,17H,2-5,10-11,16,31H2,1H3,(H4,32,33,34)(H,35,36,38) |
| InChIKey | ZVQZBXPANQFMNW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.07 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|