C32H42F4N10O4 — CID 145154421
2-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine;2-methylguanidine (PubChem CID 145154421) has the molecular formula C32H42F4N10O4 and a molecular weight of 706.75 g/mol. Its IUPAC name is 2-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine;2-methylguanidine.
| Compound Name | 2-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine;2-methylguanidine |
|---|---|
| PubChem CID | 145154421 |
| Molecular Formula | C32H42F4N10O4 |
| Molecular Weight | 706.75 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | 2-[3-[[4-[6-[5-(4-amino-5-methoxypentyl)-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methoxy]propyl]guanidine;2-methylguanidine |
| SMILES | CN=C(N)N.COCC(N)CCCc1cc(OC(F)(F)F)c(F)c(-c2cc3cn(-c4ccc(COCCCN=C(N)N)cc4)c(=O)nc3[nH]2)c1 |
| InChI | InChI=1S/C30H35F4N7O4.C2H7N3/c1-43-17-21(35)5-2-4-19-12-23(26(31)25(13-19)45-30(32,33)34)24-14-20-15-41(29(42)40-27(20)39-24)22-8-6-18(7-9-22)16-44-11-3-10-38-28(36)37;1-5-2(3)4/h6-9,12-15,21H,2-5,10-11,16-17,35H2,1H3,(H4,36,37,38)(H,39,40,42);1H3,(H4,3,4,5) |
| InChIKey | HEZGYXTYDVNTRK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 233.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|