About 5,6-diethyl-1,4-dioxine-2,3-dione;ethane
5,6-diethyl-1,4-dioxine-2,3-dione;ethane (PubChem CID 145154471) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 5,6-diethyl-1,4-dioxine-2,3-dione;ethane.
Molecular Properties
| Compound Name | 5,6-diethyl-1,4-dioxine-2,3-dione;ethane |
| PubChem CID | 145154471 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5,6-diethyl-1,4-dioxine-2,3-dione;ethane |
| SMILES | CC.CCc1oc(=O)c(=O)oc1CC |
| InChI | InChI=1S/C8H10O4.C2H6/c1-3-5-6(4-2)12-8(10)7(9)11-5;1-2/h3-4H2,1-2H3;1-2H3 |
| InChIKey | MAUMTMWIFIILNC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diethyl-1,4-dioxine-2,3-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-1,4-dioxine-2,3-dione;ethane?
The IUPAC name of 5,6-diethyl-1,4-dioxine-2,3-dione;ethane (CID 145154471) is 5,6-diethyl-1,4-dioxine-2,3-dione;ethane.
What is the SMILES notation for 5,6-diethyl-1,4-dioxine-2,3-dione;ethane?
The canonical SMILES for 5,6-diethyl-1,4-dioxine-2,3-dione;ethane is CC.CCc1oc(=O)c(=O)oc1CC.
What is the InChIKey of 5,6-diethyl-1,4-dioxine-2,3-dione;ethane?
The InChIKey is MAUMTMWIFIILNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.C2H6/c1-3-5-6(4-2)12-8(10)7(9)11-5;1-2/h3-4H2,1-2H3;1-2H3.
What are the key properties of 5,6-diethyl-1,4-dioxine-2,3-dione;ethane?
5,6-diethyl-1,4-dioxine-2,3-dione;ethane has a molecular weight of 200.23 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-1,4-dioxine-2,3-dione;ethane is sourced from PubChem (CID 145154471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).