About 3-fluoro-2,4,5-trimethylhexane
3-fluoro-2,4,5-trimethylhexane (PubChem CID 145154755) has the molecular formula C9H19F
and a molecular weight of 146.25 g/mol. Its IUPAC name is 3-fluoro-2,4,5-trimethylhexane.
Molecular Properties
| Compound Name | 3-fluoro-2,4,5-trimethylhexane |
| PubChem CID | 145154755 |
| Molecular Formula | C9H19F |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | 3-fluoro-2,4,5-trimethylhexane |
| SMILES | CC(C)C(C)C(F)C(C)C |
| InChI | InChI=1S/C9H19F/c1-6(2)8(5)9(10)7(3)4/h6-9H,1-5H3 |
| InChIKey | WPQJSEXAQSJDDD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-fluoro-2,4,5-trimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,4,5-trimethylhexane?
The IUPAC name of 3-fluoro-2,4,5-trimethylhexane (CID 145154755) is 3-fluoro-2,4,5-trimethylhexane.
What is the SMILES notation for 3-fluoro-2,4,5-trimethylhexane?
The canonical SMILES for 3-fluoro-2,4,5-trimethylhexane is CC(C)C(C)C(F)C(C)C.
What is the InChIKey of 3-fluoro-2,4,5-trimethylhexane?
The InChIKey is WPQJSEXAQSJDDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F/c1-6(2)8(5)9(10)7(3)4/h6-9H,1-5H3.
What are the key properties of 3-fluoro-2,4,5-trimethylhexane?
3-fluoro-2,4,5-trimethylhexane has a molecular weight of 146.25 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,4,5-trimethylhexane is sourced from PubChem (CID 145154755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).