C31H43N3O6 — CID 145155095
propan-2-yl (2S,3R)-2-[[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-[2-(1,4-dioxan-2-yl)ethyl]-4,5-dihydro-3H-1-benzazepin-8-yl]methylamino]-3-hydroxybutanoate (PubChem CID 145155095) has the molecular formula C31H43N3O6 and a molecular weight of 553.70 g/mol. Its IUPAC name is propan-2-yl (2S,3R)-2-[[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-[2-(1,4-dioxan-2-yl)ethyl]-4,5-dihydro-3H-1-benzazepin-8-yl]methylamino]-3-hydroxybutanoate.
| Compound Name | propan-2-yl (2S,3R)-2-[[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-[2-(1,4-dioxan-2-yl)ethyl]-4,5-dihydro-3H-1-benzazepin-8-yl]methylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 145155095 |
| Molecular Formula | C31H43N3O6 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | propan-2-yl (2S,3R)-2-[[2-(1,5-dimethyl-6-oxo-3-pyridinyl)-3-[2-(1,4-dioxan-2-yl)ethyl]-4,5-dihydro-3H-1-benzazepin-8-yl]methylamino]-3-hydroxybutanoate |
| SMILES | Cc1cc(C2=Nc3cc(CN[C@H](C(=O)OC(C)C)[C@@H](C)O)ccc3CCC2CCC2COCCO2)cn(C)c1=O |
| InChI | InChI=1S/C31H43N3O6/c1-19(2)40-31(37)28(21(4)35)32-16-22-6-7-23-8-9-24(10-11-26-18-38-12-13-39-26)29(33-27(23)15-22)25-14-20(3)30(36)34(5)17-25/h6-7,14-15,17,19,21,24,26,28,32,35H,8-13,16,18H2,1-5H3/t21-,24?,26?,28+/m1/s1 |
| InChIKey | YWKWQSHAMSGEHL-USKYPORHSA-N |
| XLogP | 3.36 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |