About 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane
1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane (PubChem CID 145155320) has the molecular formula C18H33N6O+
and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane.
Molecular Properties
| Compound Name | 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane |
| PubChem CID | 145155320 |
| Molecular Formula | C18H33N6O+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane |
| SMILES | CC.CC.Cn1cc[n+](C)c1/N=N/c1ccc(NCC(O)CN)cc1 |
| InChI | InChI=1S/C14H20N6O.2C2H6/c1-19-7-8-20(2)14(19)18-17-12-5-3-11(4-6-12)16-10-13(21)9-15;2*1-2/h3-8,13,21H,9-10,15H2,1-2H3;2*1-2H3/p+1 |
| InChIKey | ANZQGBWBMGEHKX-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane?
The IUPAC name of 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane (CID 145155320) is 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane.
What is the SMILES notation for 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane?
The canonical SMILES for 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane is CC.CC.Cn1cc[n+](C)c1/N=N/c1ccc(NCC(O)CN)cc1.
What is the InChIKey of 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane?
The InChIKey is ANZQGBWBMGEHKX-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H20N6O.2C2H6/c1-19-7-8-20(2)14(19)18-17-12-5-3-11(4-6-12)16-10-13(21)9-15;2*1-2/h3-8,13,21H,9-10,15H2,1-2H3;2*1-2H3/p+1.
What are the key properties of 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane?
1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane has a molecular weight of 349.50 g/mol, XLogP of 3.05, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]anilino]propan-2-ol;ethane is sourced from PubChem (CID 145155320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).