C23H28F3N3O2S — CID 145155796
1,1,1-trifluoro-4-imino-4-[5-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridinyl]but-2-en-2-amine (PubChem CID 145155796) has the molecular formula C23H28F3N3O2S and a molecular weight of 467.56 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-imino-4-[5-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridinyl]but-2-en-2-amine.
| Compound Name | 1,1,1-trifluoro-4-imino-4-[5-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridinyl]but-2-en-2-amine |
|---|---|
| PubChem CID | 145155796 |
| Molecular Formula | C23H28F3N3O2S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 1,1,1-trifluoro-4-imino-4-[5-(7-octyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridinyl]but-2-en-2-amine |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1ccc(-c2sc(CCCCCCCC)c3c2OCCO3)cn1 |
| InChI | InChI=1S/C23H28F3N3O2S/c1-2-3-4-5-6-7-8-18-20-21(31-12-11-30-20)22(32-18)15-9-10-17(29-14-15)16(27)13-19(28)23(24,25)26/h9-10,13-14,27H,2-8,11-12,28H2,1H3/b19-13?,27-16+ |
| InChIKey | WGMNJGAZZKYAHG-JGLJBVBFSA-N |
| XLogP | 6.26 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|