C34H21F3N6O7RuS2 — CID 145155984
2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium;[2-[5-(5-sulfanylfuran-2-yl)-2-pyridinyl]-4-(trifluoromethyl)pyrrol-1-yl]methyl thiocyanate (PubChem CID 145155984) has the molecular formula C34H21F3N6O7RuS2 and a molecular weight of 847.77 g/mol. Its IUPAC name is 2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium;[2-[5-(5-sulfanylfuran-2-yl)-2-pyridinyl]-4-(trifluoromethyl)pyrrol-1-yl]methyl thiocyanate.
| Compound Name | 2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium;[2-[5-(5-sulfanylfuran-2-yl)-2-pyridinyl]-4-(trifluoromethyl)pyrrol-1-yl]methyl thiocyanate |
|---|---|
| PubChem CID | 145155984 |
| Molecular Formula | C34H21F3N6O7RuS2 |
| Molecular Weight | 847.77 g/mol |
| Exact Mass | 847.99 |
| IUPAC Name | 2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;ruthenium;[2-[5-(5-sulfanylfuran-2-yl)-2-pyridinyl]-4-(trifluoromethyl)pyrrol-1-yl]methyl thiocyanate |
| SMILES | N#CSCn1cc(C(F)(F)F)cc1-c1ccc(-c2ccc(S)o2)cn1.O=C(O)c1ccnc(-c2cc(C(=O)O)cc(-c3cc(C(=O)O)ccn3)n2)c1.[Ru] |
| InChI | InChI=1S/C18H11N3O6.C16H10F3N3OS2.Ru/c22-16(23)9-1-3-19-12(5-9)14-7-11(18(26)27)8-15(21-14)13-6-10(17(24)25)2-4-20-13;17-16(18,19)11-5-13(22(7-11)9-25-8-20)12-2-1-10(6-21-12)14-3-4-15(24)23-14;/h1-8H,(H,22,23)(H,24,25)(H,26,27);1-7,24H,9H2; |
| InChIKey | CHMCSAYJRBXNIH-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.77 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|