C32H19F3N8O6RuS4 — CID 145155991
2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[5-[5-[5-(disulfanyl)thiophen-2-yl]-2-pyridinyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl thiocyanate;ruthenium (PubChem CID 145155991) has the molecular formula C32H19F3N8O6RuS4 and a molecular weight of 897.89 g/mol. Its IUPAC name is 2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[5-[5-[5-(disulfanyl)thiophen-2-yl]-2-pyridinyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl thiocyanate;ruthenium.
| Compound Name | 2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[5-[5-[5-(disulfanyl)thiophen-2-yl]-2-pyridinyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl thiocyanate;ruthenium |
|---|---|
| PubChem CID | 145155991 |
| Molecular Formula | C32H19F3N8O6RuS4 |
| Molecular Weight | 897.89 g/mol |
| Exact Mass | 897.93 |
| IUPAC Name | 2,6-bis(4-carboxy-2-pyridinyl)pyridine-4-carboxylic acid;[5-[5-[5-(disulfanyl)thiophen-2-yl]-2-pyridinyl]-3-(trifluoromethyl)-1,2,4-triazol-1-yl]methyl thiocyanate;ruthenium |
| SMILES | N#CSCn1nc(C(F)(F)F)nc1-c1ccc(-c2ccc(SS)s2)cn1.O=C(O)c1ccnc(-c2cc(C(=O)O)cc(-c3cc(C(=O)O)ccn3)n2)c1.[Ru] |
| InChI | InChI=1S/C18H11N3O6.C14H8F3N5S4.Ru/c22-16(23)9-1-3-19-12(5-9)14-7-11(18(26)27)8-15(21-14)13-6-10(17(24)25)2-4-20-13;15-14(16,17)13-20-12(22(21-13)7-24-6-18)9-2-1-8(5-19-9)10-3-4-11(25-10)26-23;/h1-8H,(H,22,23)(H,24,25)(H,26,27);1-5,23H,7H2; |
| InChIKey | QUOJCWCDHWMRHZ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 217.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.89 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|