About 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline
5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline (PubChem CID 145156034) has the molecular formula C10H14FNS
and a molecular weight of 199.29 g/mol. Its IUPAC name is 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline.
Molecular Properties
| Compound Name | 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline |
| PubChem CID | 145156034 |
| Molecular Formula | C10H14FNS |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline |
| SMILES | C=S(C)Nc1cc(F)c(C)cc1C |
| InChI | InChI=1S/C10H14FNS/c1-7-5-8(2)10(6-9(7)11)12-13(3)4/h5-6,12H,3H2,1-2,4H3 |
| InChIKey | BSYTVTHFGBFLRS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline?
The IUPAC name of 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline (CID 145156034) is 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline.
What is the SMILES notation for 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline?
The canonical SMILES for 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline is C=S(C)Nc1cc(F)c(C)cc1C.
What is the InChIKey of 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline?
The InChIKey is BSYTVTHFGBFLRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNS/c1-7-5-8(2)10(6-9(7)11)12-13(3)4/h5-6,12H,3H2,1-2,4H3.
What are the key properties of 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline?
5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline has a molecular weight of 199.29 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4-dimethyl-N-[methyl(methylidene)-λ4-sulfanyl]aniline is sourced from PubChem (CID 145156034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).