C16H27N3 — CID 145157040
[3-(4-prop-1-en-2-ylcyclohexen-1-yl)-3-pyrrolidin-1-ylprop-1-en-2-yl]hydrazine (PubChem CID 145157040) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is [3-(4-prop-1-en-2-ylcyclohexen-1-yl)-3-pyrrolidin-1-ylprop-1-en-2-yl]hydrazine.
| Compound Name | [3-(4-prop-1-en-2-ylcyclohexen-1-yl)-3-pyrrolidin-1-ylprop-1-en-2-yl]hydrazine |
|---|---|
| PubChem CID | 145157040 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | [3-(4-prop-1-en-2-ylcyclohexen-1-yl)-3-pyrrolidin-1-ylprop-1-en-2-yl]hydrazine |
| SMILES | C=C(C)C1CC=C(C(C(=C)NN)N2CCCC2)CC1 |
| InChI | InChI=1S/C16H27N3/c1-12(2)14-6-8-15(9-7-14)16(13(3)18-17)19-10-4-5-11-19/h8,14,16,18H,1,3-7,9-11,17H2,2H3 |
| InChIKey | HALKJTALMJIXLD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|