C13H13N5 — CID 145157569
11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene (PubChem CID 145157569) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene.
| Compound Name | 11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
|---|---|
| PubChem CID | 145157569 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 11-(1-methylpyrazol-4-yl)-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraene |
| SMILES | Cn1cc(-c2ccc3nc4n(c3n2)CCC4)cn1 |
| InChI | InChI=1S/C13H13N5/c1-17-8-9(7-14-17)10-4-5-11-13(16-10)18-6-2-3-12(18)15-11/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | OQGZVQOFFMMUFD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |