C25H29ClFN5O2 — CID 145157724
2,7-diamino-N-[[3-[4-chloro-2-(2-fluorobenzoyl)phenyl]-2-methylimidazol-4-yl]methyl]heptanamide (PubChem CID 145157724) has the molecular formula C25H29ClFN5O2 and a molecular weight of 485.99 g/mol. Its IUPAC name is 2,7-diamino-N-[[3-[4-chloro-2-(2-fluorobenzoyl)phenyl]-2-methylimidazol-4-yl]methyl]heptanamide.
| Compound Name | 2,7-diamino-N-[[3-[4-chloro-2-(2-fluorobenzoyl)phenyl]-2-methylimidazol-4-yl]methyl]heptanamide |
|---|---|
| PubChem CID | 145157724 |
| Molecular Formula | C25H29ClFN5O2 |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2,7-diamino-N-[[3-[4-chloro-2-(2-fluorobenzoyl)phenyl]-2-methylimidazol-4-yl]methyl]heptanamide |
| SMILES | Cc1ncc(CNC(=O)C(N)CCCCCN)n1-c1ccc(Cl)cc1C(=O)c1ccccc1F |
| InChI | InChI=1S/C25H29ClFN5O2/c1-16-30-14-18(15-31-25(34)22(29)9-3-2-6-12-28)32(16)23-11-10-17(26)13-20(23)24(33)19-7-4-5-8-21(19)27/h4-5,7-8,10-11,13-14,22H,2-3,6,9,12,15,28-29H2,1H3,(H,31,34) |
| InChIKey | OVGKLMWMQGZJCZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|