About 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane
1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane (PubChem CID 145157784) has the molecular formula C17H32OS
and a molecular weight of 284.51 g/mol. Its IUPAC name is 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane.
Molecular Properties
| Compound Name | 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane |
| PubChem CID | 145157784 |
| Molecular Formula | C17H32OS |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane |
| SMILES | C=C(C)/C=C\C(=C)OCCCCCCCCCC.S |
| InChI | InChI=1S/C17H30O.H2S/c1-5-6-7-8-9-10-11-12-15-18-17(4)14-13-16(2)3;/h13-14H,2,4-12,15H2,1,3H3;1H2/b14-13-; |
| InChIKey | CAUCBERLGLXFRK-HPWRNOGASA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane?
The IUPAC name of 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane (CID 145157784) is 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane.
What is the SMILES notation for 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane?
The canonical SMILES for 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane is C=C(C)/C=C\C(=C)OCCCCCCCCCC.S.
What is the InChIKey of 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane?
The InChIKey is CAUCBERLGLXFRK-HPWRNOGASA-N. The full InChI is InChI=1S/C17H30O.H2S/c1-5-6-7-8-9-10-11-12-15-18-17(4)14-13-16(2)3;/h13-14H,2,4-12,15H2,1,3H3;1H2/b14-13-;.
What are the key properties of 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane?
1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane has a molecular weight of 284.51 g/mol, XLogP of 5.90, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]oxydecane;sulfane is sourced from PubChem (CID 145157784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).