C26H26N2O3S — CID 145159822
N-(2-ethoxyphenyl)-2-(2-hydroxy-N-(4-methylphenyl)sulfanylanilino)-N-prop-2-ynylacetamide (PubChem CID 145159822) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-(2-hydroxy-N-(4-methylphenyl)sulfanylanilino)-N-prop-2-ynylacetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-(2-hydroxy-N-(4-methylphenyl)sulfanylanilino)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 145159822 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-(2-hydroxy-N-(4-methylphenyl)sulfanylanilino)-N-prop-2-ynylacetamide |
| SMILES | C#CCN(C(=O)CN(Sc1ccc(C)cc1)c1ccccc1O)c1ccccc1OCC |
| InChI | InChI=1S/C26H26N2O3S/c1-4-18-27(23-11-7-9-13-25(23)31-5-2)26(30)19-28(22-10-6-8-12-24(22)29)32-21-16-14-20(3)15-17-21/h1,6-17,29H,5,18-19H2,2-3H3 |
| InChIKey | AAAHZYABEGRJML-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|