About (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium
(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium (PubChem CID 145160130) has the molecular formula C14H10NO6S+
and a molecular weight of 320.30 g/mol. Its IUPAC name is (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium.
Molecular Properties
| Compound Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium |
| PubChem CID | 145160130 |
| Molecular Formula | C14H10NO6S+ |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium |
| SMILES | [NH3+]OS(=O)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO6S/c15-21-22(20)9-5-8(16)10-11(14(9)19)13(18)7-4-2-1-3-6(7)12(10)17/h1-5H,15H3,(H-,16,17,18,19)/p+1 |
| InChIKey | BGUSCUVDPRHWCS-UHFFFAOYSA-O |
| XLogP | 0.07 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium?
The IUPAC name of (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium (CID 145160130) is (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium.
What is the SMILES notation for (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium?
The canonical SMILES for (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium is [NH3+]OS(=O)c1cc(O)c2c(c1O)C(=O)c1ccccc1C2=O.
What is the InChIKey of (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium?
The InChIKey is BGUSCUVDPRHWCS-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H9NO6S/c15-21-22(20)9-5-8(16)10-11(14(9)19)13(18)7-4-2-1-3-6(7)12(10)17/h1-5H,15H3,(H-,16,17,18,19)/p+1.
What are the key properties of (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium?
(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium has a molecular weight of 320.30 g/mol, XLogP of 0.07, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dihydroxy-9,10-dioxoanthracen-2-yl)sulfinyloxyazanium is sourced from PubChem (CID 145160130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).