C15H17IOS — CID 145160140
(6,7-dimethyl-9-oxo-4,5,8,9a-tetrahydro-1H-fluoren-4a-yl) thiohypoiodite (PubChem CID 145160140) has the molecular formula C15H17IOS and a molecular weight of 372.27 g/mol. Its IUPAC name is (6,7-dimethyl-9-oxo-4,5,8,9a-tetrahydro-1H-fluoren-4a-yl) thiohypoiodite.
| Compound Name | (6,7-dimethyl-9-oxo-4,5,8,9a-tetrahydro-1H-fluoren-4a-yl) thiohypoiodite |
|---|---|
| PubChem CID | 145160140 |
| Molecular Formula | C15H17IOS |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | (6,7-dimethyl-9-oxo-4,5,8,9a-tetrahydro-1H-fluoren-4a-yl) thiohypoiodite |
| SMILES | CC1=C(C)CC2=C(C1)C(=O)C1CC=CCC21SI |
| InChI | InChI=1S/C15H17IOS/c1-9-7-11-13(8-10(9)2)15(18-16)6-4-3-5-12(15)14(11)17/h3-4,12H,5-8H2,1-2H3 |
| InChIKey | HYVIAGQJXZXPPG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|