About CID 145160343
CID 145160343 (PubChem CID 145160343) has the molecular formula C15H10BN3O4
and a molecular weight of 307.07 g/mol.
Molecular Properties
| Compound Name | CID 145160343 |
| PubChem CID | 145160343 |
| Molecular Formula | C15H10BN3O4 |
| Molecular Weight | 307.07 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | — |
| SMILES | [B]c1nc(C(=O)NCC(=O)O)c(O)cc1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H10BN3O4/c16-14-10(9-3-1-2-8(4-9)6-17)5-11(20)13(19-14)15(23)18-7-12(21)22/h1-5,20H,7H2,(H,18,23)(H,21,22) |
| InChIKey | LSJOGPCTWZAZHI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 123.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.07 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145160343 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145160343?
The IUPAC name of CID 145160343 (CID 145160343) is not available.
What is the SMILES notation for CID 145160343?
The canonical SMILES for CID 145160343 is [B]c1nc(C(=O)NCC(=O)O)c(O)cc1-c1cccc(C#N)c1.
What is the InChIKey of CID 145160343?
The InChIKey is LSJOGPCTWZAZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BN3O4/c16-14-10(9-3-1-2-8(4-9)6-17)5-11(20)13(19-14)15(23)18-7-12(21)22/h1-5,20H,7H2,(H,18,23)(H,21,22).
What are the key properties of CID 145160343?
CID 145160343 has a molecular weight of 307.07 g/mol, XLogP of -0.07, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145160343 is sourced from PubChem (CID 145160343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).