C27H25N5O3S — CID 145160427
5-[(4R)-8-but-1-ynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole;methylsulfanylmethane (PubChem CID 145160427) has the molecular formula C27H25N5O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 5-[(4R)-8-but-1-ynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole;methylsulfanylmethane.
| Compound Name | 5-[(4R)-8-but-1-ynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole;methylsulfanylmethane |
|---|---|
| PubChem CID | 145160427 |
| Molecular Formula | C27H25N5O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 5-[(4R)-8-but-1-ynyl-4-methyl-6-(2-nitrophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]-1,3-oxazole;methylsulfanylmethane |
| SMILES | CCC#Cc1ccc2c(c1)C(c1ccccc1[N+](=O)[O-])=N[C@H](C)c1c(-c3cnco3)ncn1-2.CSC |
| InChI | InChI=1S/C25H19N5O3.C2H6S/c1-3-4-7-17-10-11-20-19(12-17)23(18-8-5-6-9-21(18)30(31)32)28-16(2)25-24(27-14-29(20)25)22-13-26-15-33-22;1-3-2/h5-6,8-16H,3H2,1-2H3;1-2H3/t16-;/m1./s1 |
| InChIKey | AOGOWNHZMKEFOI-PKLMIRHRSA-N |
| XLogP | 6.09 |
| TPSA | 99.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|