C21H17ClN2O4S2 — CID 145160920
N-[(5Z)-5-[3-(1,3-benzodioxol-5-yl)propylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chloro-4-methylbenzamide (PubChem CID 145160920) has the molecular formula C21H17ClN2O4S2 and a molecular weight of 460.96 g/mol. Its IUPAC name is N-[(5Z)-5-[3-(1,3-benzodioxol-5-yl)propylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chloro-4-methylbenzamide.
| Compound Name | N-[(5Z)-5-[3-(1,3-benzodioxol-5-yl)propylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 145160920 |
| Molecular Formula | C21H17ClN2O4S2 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | N-[(5Z)-5-[3-(1,3-benzodioxol-5-yl)propylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chloro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN2C(=O)/C(=C/CCc3ccc4c(c3)OCO4)SC2=S)c(Cl)c1 |
| InChI | InChI=1S/C21H17ClN2O4S2/c1-12-5-7-14(15(22)9-12)19(25)23-24-20(26)18(30-21(24)29)4-2-3-13-6-8-16-17(10-13)28-11-27-16/h4-10H,2-3,11H2,1H3,(H,23,25)/b18-4- |
| InChIKey | GEQCECNWIMDYBZ-LMXLVEHLSA-N |
| XLogP | 4.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|