About 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol
2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol (PubChem CID 145161184) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol |
| PubChem CID | 145161184 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol |
| SMILES | Oc1cccnc1C1=NCCS1 |
| InChI | InChI=1S/C8H8N2OS/c11-6-2-1-3-9-7(6)8-10-4-5-12-8/h1-3,11H,4-5H2 |
| InChIKey | UYBLCYBDKQMFJM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol?
The IUPAC name of 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol (CID 145161184) is 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol.
What is the SMILES notation for 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol?
The canonical SMILES for 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol is Oc1cccnc1C1=NCCS1.
What is the InChIKey of 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol?
The InChIKey is UYBLCYBDKQMFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c11-6-2-1-3-9-7(6)8-10-4-5-12-8/h1-3,11H,4-5H2.
What are the key properties of 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol?
2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol has a molecular weight of 180.23 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1,3-thiazol-2-yl)pyridin-3-ol is sourced from PubChem (CID 145161184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).