C14H17N3O5S2 — CID 145162087
[(2S)-7-oxo-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-2-yl]methyl methanesulfonate (PubChem CID 145162087) has the molecular formula C14H17N3O5S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is [(2S)-7-oxo-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-2-yl]methyl methanesulfonate.
| Compound Name | [(2S)-7-oxo-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 145162087 |
| Molecular Formula | C14H17N3O5S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | [(2S)-7-oxo-6-prop-2-enoxy-3-(1,3-thiazol-2-yl)-1,6-diazabicyclo[3.2.1]oct-3-en-2-yl]methyl methanesulfonate |
| SMILES | C=CCON1C(=O)N2CC1C=C(c1nccs1)[C@H]2COS(C)(=O)=O |
| InChI | InChI=1S/C14H17N3O5S2/c1-3-5-21-17-10-7-11(13-15-4-6-23-13)12(9-22-24(2,19)20)16(8-10)14(17)18/h3-4,6-7,10,12H,1,5,8-9H2,2H3/t10?,12-/m1/s1 |
| InChIKey | SDCNGDFEWZOPGU-TVKKRMFBSA-N |
| XLogP | 1.11 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|