About N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol
N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol (PubChem CID 145162116) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol.
Molecular Properties
| Compound Name | N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol |
| PubChem CID | 145162116 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol |
| SMILES | C=CCON(C=O)[C@H]1CN(C)CC=C1C.CC.CO |
| InChI | InChI=1S/C11H18N2O2.C2H6.CH4O/c1-4-7-15-13(9-14)11-8-12(3)6-5-10(11)2;2*1-2/h4-5,9,11H,1,6-8H2,2-3H3;1-2H3;2H,1H3/t11-;;/m0../s1 |
| InChIKey | WQEAFTVERBOMFD-IDMXKUIJSA-N |
| XLogP | 1.46 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol?
The IUPAC name of N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol (CID 145162116) is N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol.
What is the SMILES notation for N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol?
The canonical SMILES for N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol is C=CCON(C=O)[C@H]1CN(C)CC=C1C.CC.CO.
What is the InChIKey of N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol?
The InChIKey is WQEAFTVERBOMFD-IDMXKUIJSA-N. The full InChI is InChI=1S/C11H18N2O2.C2H6.CH4O/c1-4-7-15-13(9-14)11-8-12(3)6-5-10(11)2;2*1-2/h4-5,9,11H,1,6-8H2,2-3H3;1-2H3;2H,1H3/t11-;;/m0../s1.
What are the key properties of N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol?
N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol has a molecular weight of 272.39 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-1,4-dimethyl-3,6-dihydro-2H-pyridin-3-yl]-N-prop-2-enoxyformamide;ethane;methanol is sourced from PubChem (CID 145162116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).