About acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine
acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine (PubChem CID 145162304) has the molecular formula C17H33N3O
and a molecular weight of 295.47 g/mol. Its IUPAC name is acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine.
Molecular Properties
| Compound Name | acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine |
| PubChem CID | 145162304 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine |
| SMILES | C=C(/C=C\C)CC.C=C(N)C1CCC(C)NC1.CC(N)=O |
| InChI | InChI=1S/C8H16N2.C7H12.C2H5NO/c1-6-3-4-8(5-10-6)7(2)9;1-4-6-7(3)5-2;1-2(3)4/h6,8,10H,2-5,9H2,1H3;4,6H,3,5H2,1-2H3;1H3,(H2,3,4)/b;6-4-; |
| InChIKey | SCCWBEUTORZSAD-GONQOWGMSA-N |
| XLogP | 2.87 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine?
The IUPAC name of acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine (CID 145162304) is acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine.
What is the SMILES notation for acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine?
The canonical SMILES for acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine is C=C(/C=C\C)CC.C=C(N)C1CCC(C)NC1.CC(N)=O.
What is the InChIKey of acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine?
The InChIKey is SCCWBEUTORZSAD-GONQOWGMSA-N. The full InChI is InChI=1S/C8H16N2.C7H12.C2H5NO/c1-6-3-4-8(5-10-6)7(2)9;1-4-6-7(3)5-2;1-2(3)4/h6,8,10H,2-5,9H2,1H3;4,6H,3,5H2,1-2H3;1H3,(H2,3,4)/b;6-4-;.
What are the key properties of acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine?
acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine has a molecular weight of 295.47 g/mol, XLogP of 2.87, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;(Z)-4-methylidenehex-2-ene;1-(6-methylpiperidin-3-yl)ethenamine is sourced from PubChem (CID 145162304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).