C34H37N3O2S — CID 145162792
(5Z)-1-ethyl-5-[(2E)-2-[3-methyl-3-(naphthalen-2-ylmethyl)-1-propylindol-2-ylidene]ethylidene]-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 145162792) has the molecular formula C34H37N3O2S and a molecular weight of 551.76 g/mol. Its IUPAC name is (5Z)-1-ethyl-5-[(2E)-2-[3-methyl-3-(naphthalen-2-ylmethyl)-1-propylindol-2-ylidene]ethylidene]-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-1-ethyl-5-[(2E)-2-[3-methyl-3-(naphthalen-2-ylmethyl)-1-propylindol-2-ylidene]ethylidene]-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 145162792 |
| Molecular Formula | C34H37N3O2S |
| Molecular Weight | 551.76 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (5Z)-1-ethyl-5-[(2E)-2-[3-methyl-3-(naphthalen-2-ylmethyl)-1-propylindol-2-ylidene]ethylidene]-3-propyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCN1C(=O)/C(=C\C=C2\N(CCC)c3ccccc3C2(C)Cc2ccc3ccccc3c2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C34H37N3O2S/c1-5-20-36-29-15-11-10-14-28(29)34(4,23-24-16-17-25-12-8-9-13-26(25)22-24)30(36)19-18-27-31(38)35(7-3)33(40)37(21-6-2)32(27)39/h8-19,22H,5-7,20-21,23H2,1-4H3/b27-18-,30-19+ |
| InChIKey | UVTKXUWHCUPBJA-ZVDXXVHTSA-N |
| XLogP | 6.77 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.76 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|