About ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate
ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate (PubChem CID 145162890) has the molecular formula C9H13F3N2O3
and a molecular weight of 254.21 g/mol. Its IUPAC name is ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate |
| PubChem CID | 145162890 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(/NN(C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O3/c1-4-17-8(16)5-7(9(10,11)12)13-14(3)6(2)15/h5,13H,4H2,1-3H3/b7-5+ |
| InChIKey | RXRGGALLALGYJS-FNORWQNLSA-N |
| XLogP | 0.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate?
The IUPAC name of ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate (CID 145162890) is ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate.
What is the SMILES notation for ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate?
The canonical SMILES for ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate is CCOC(=O)/C=C(/NN(C)C(C)=O)C(F)(F)F.
What is the InChIKey of ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate?
The InChIKey is RXRGGALLALGYJS-FNORWQNLSA-N. The full InChI is InChI=1S/C9H13F3N2O3/c1-4-17-8(16)5-7(9(10,11)12)13-14(3)6(2)15/h5,13H,4H2,1-3H3/b7-5+.
What are the key properties of ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate?
ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate has a molecular weight of 254.21 g/mol, XLogP of 0.98, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-(2-acetyl-2-methylhydrazinyl)-4,4,4-trifluorobut-2-enoate is sourced from PubChem (CID 145162890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).