C35H39N7O7 — CID 145163530
(2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate;(E)-2-prop-1-en-2-ylbut-2-enenitrile (PubChem CID 145163530) has the molecular formula C35H39N7O7 and a molecular weight of 669.74 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate;(E)-2-prop-1-en-2-ylbut-2-enenitrile.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate;(E)-2-prop-1-en-2-ylbut-2-enenitrile |
|---|---|
| PubChem CID | 145163530 |
| Molecular Formula | C35H39N7O7 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[6-[(2-cyano-4-nitrophenyl)diazenyl]-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]butanoate;(E)-2-prop-1-en-2-ylbut-2-enenitrile |
| SMILES | C=C(C)/C(C#N)=C\C.COc1cc2c(cc1/N=N/c1ccc([N+](=O)[O-])cc1C#N)C(C)CC(C)(C)N2CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H30N6O7.C7H9N/c1-17-15-28(2,3)32(11-5-6-27(37)41-33-25(35)9-10-26(33)36)23-14-24(40-4)22(13-20(17)23)31-30-21-8-7-19(34(38)39)12-18(21)16-29;1-4-7(5-8)6(2)3/h7-8,12-14,17H,5-6,9-11,15H2,1-4H3;4H,2H2,1,3H3/b31-30+;7-4- |
| InChIKey | RGBHXRNLFGZIDG-VYIGAXDFSA-N |
| XLogP | 7.40 |
| TPSA | 191.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|