About ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate
ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate (PubChem CID 145163931) has the molecular formula C10H18N4O2S
and a molecular weight of 258.35 g/mol. Its IUPAC name is ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate |
| PubChem CID | 145163931 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)NC1=C(CC)CN(C)N1 |
| InChI | InChI=1S/C10H18N4O2S/c1-4-7-6-14(3)13-8(7)11-9(17)12-10(15)16-5-2/h13H,4-6H2,1-3H3,(H2,11,12,15,17) |
| InChIKey | KZKJWAKOQIWVJI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate?
The IUPAC name of ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate (CID 145163931) is ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate.
What is the SMILES notation for ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate?
The canonical SMILES for ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate is CCOC(=O)NC(=S)NC1=C(CC)CN(C)N1.
What is the InChIKey of ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate?
The InChIKey is KZKJWAKOQIWVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2S/c1-4-7-6-14(3)13-8(7)11-9(17)12-10(15)16-5-2/h13H,4-6H2,1-3H3,(H2,11,12,15,17).
What are the key properties of ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate?
ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate has a molecular weight of 258.35 g/mol, XLogP of 0.68, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(4-ethyl-2-methyl-1,3-dihydropyrazol-5-yl)carbamothioyl]carbamate is sourced from PubChem (CID 145163931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).