About N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene
N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene (PubChem CID 145164199) has the molecular formula C21H27F3N2O
and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene.
Molecular Properties
| Compound Name | N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene |
| PubChem CID | 145164199 |
| Molecular Formula | C21H27F3N2O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene |
| SMILES | CCNCCN(C=O)Cc1cccc(C(F)(F)F)c1.CCc1ccccc1 |
| InChI | InChI=1S/C13H17F3N2O.C8H10/c1-2-17-6-7-18(10-19)9-11-4-3-5-12(8-11)13(14,15)16;1-2-8-6-4-3-5-7-8/h3-5,8,10,17H,2,6-7,9H2,1H3;3-7H,2H2,1H3 |
| InChIKey | UOGGIZMEVNZUFG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene?
The IUPAC name of N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene (CID 145164199) is N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene.
What is the SMILES notation for N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene?
The canonical SMILES for N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene is CCNCCN(C=O)Cc1cccc(C(F)(F)F)c1.CCc1ccccc1.
What is the InChIKey of N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene?
The InChIKey is UOGGIZMEVNZUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N2O.C8H10/c1-2-17-6-7-18(10-19)9-11-4-3-5-12(8-11)13(14,15)16;1-2-8-6-4-3-5-7-8/h3-5,8,10,17H,2,6-7,9H2,1H3;3-7H,2H2,1H3.
What are the key properties of N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene?
N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene has a molecular weight of 380.45 g/mol, XLogP of 4.52, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(ethylamino)ethyl]-N-[[3-(trifluoromethyl)phenyl]methyl]formamide;ethylbenzene is sourced from PubChem (CID 145164199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).