About ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole
ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole (PubChem CID 145164701) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole.
Molecular Properties
| Compound Name | ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole |
| PubChem CID | 145164701 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole |
| SMILES | CC.c1ccc(-c2cc3n(n2)CCO3)cc1 |
| InChI | InChI=1S/C11H10N2O.C2H6/c1-2-4-9(5-3-1)10-8-11-13(12-10)6-7-14-11;1-2/h1-5,8H,6-7H2;1-2H3 |
| InChIKey | SKKOULRRNMWFPJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
The IUPAC name of ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole (CID 145164701) is ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole.
What is the SMILES notation for ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
The canonical SMILES for ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole is CC.c1ccc(-c2cc3n(n2)CCO3)cc1.
What is the InChIKey of ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
The InChIKey is SKKOULRRNMWFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O.C2H6/c1-2-4-9(5-3-1)10-8-11-13(12-10)6-7-14-11;1-2/h1-5,8H,6-7H2;1-2H3.
What are the key properties of ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole?
ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole has a molecular weight of 216.28 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-phenyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazole is sourced from PubChem (CID 145164701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).