C14H18N2O2 — CID 145166607
3-(benzylamino)-4-(methylamino)cyclobut-3-ene-1,2-dione;ethane (PubChem CID 145166607) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(benzylamino)-4-(methylamino)cyclobut-3-ene-1,2-dione;ethane.
| Compound Name | 3-(benzylamino)-4-(methylamino)cyclobut-3-ene-1,2-dione;ethane |
|---|---|
| PubChem CID | 145166607 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-(benzylamino)-4-(methylamino)cyclobut-3-ene-1,2-dione;ethane |
| SMILES | CC.CNc1c(NCc2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C12H12N2O2.C2H6/c1-13-9-10(12(16)11(9)15)14-7-8-5-3-2-4-6-8;1-2/h2-6,13-14H,7H2,1H3;1-2H3 |
| InChIKey | GUPFRYDGRWOCHE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|