About 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen
3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen (PubChem CID 145166691) has the molecular formula C6H14F2N2O
and a molecular weight of 168.19 g/mol. Its IUPAC name is 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen.
Analyze 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen?
The IUPAC name of 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen (CID 145166691) is 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen.
What is the SMILES notation for 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen?
The canonical SMILES for 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen is CC.NC(=O)N1CC(F)(F)C1.[H][H].
What is the InChIKey of 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen?
The InChIKey is HDFKYFYUTBJSJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2N2O.C2H6.H2/c5-4(6)1-8(2-4)3(7)9;1-2;/h1-2H2,(H2,7,9);1-2H3;1H.
What are the key properties of 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen?
3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen has a molecular weight of 168.19 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoroazetidine-1-carboxamide;ethane;molecular hydrogen is sourced from PubChem (CID 145166691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).