C10H11N3O2S2 — CID 14516778
ethyl 1-(4-methyl-1,3-thiazol-2-yl)-5-sulfanylimidazole-4-carboxylate (PubChem CID 14516778) has the molecular formula C10H11N3O2S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is ethyl 1-(4-methyl-1,3-thiazol-2-yl)-5-sulfanylimidazole-4-carboxylate.
| Compound Name | ethyl 1-(4-methyl-1,3-thiazol-2-yl)-5-sulfanylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 14516778 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | ethyl 1-(4-methyl-1,3-thiazol-2-yl)-5-sulfanylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn(-c2nc(C)cs2)c1S |
| InChI | InChI=1S/C10H11N3O2S2/c1-3-15-9(14)7-8(16)13(5-11-7)10-12-6(2)4-17-10/h4-5,16H,3H2,1-2H3 |
| InChIKey | ZCOBAEUJEDULTB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|