C15H30N6O — CID 14516817
4-[[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol (PubChem CID 14516817) has the molecular formula C15H30N6O and a molecular weight of 310.45 g/mol. Its IUPAC name is 4-[[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol.
| Compound Name | 4-[[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 14516817 |
| Molecular Formula | C15H30N6O |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 4-[[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]amino]butan-1-ol |
| SMILES | CC(C)(C)Nc1nc(NCCCCO)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C15H30N6O/c1-14(2,3)20-12-17-11(16-9-7-8-10-22)18-13(19-12)21-15(4,5)6/h22H,7-10H2,1-6H3,(H3,16,17,18,19,20,21) |
| InChIKey | YAEJSCUXOFDULO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|