C23H42 — CID 145168944
10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methane;molecular hydrogen (PubChem CID 145168944) has the molecular formula C23H42 and a molecular weight of 318.59 g/mol. Its IUPAC name is 10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methane;molecular hydrogen.
| Compound Name | 10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methane;molecular hydrogen |
|---|---|
| PubChem CID | 145168944 |
| Molecular Formula | C23H42 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 318.33 |
| IUPAC Name | 10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene;methane;molecular hydrogen |
| SMILES | C.C=C(C)C1CCC2C3CCC4CCCCC4(C)C3CCC12C.[H][H] |
| InChI | InChI=1S/C22H36.CH4.H2/c1-15(2)18-10-11-19-17-9-8-16-7-5-6-13-21(16,3)20(17)12-14-22(18,19)4;;/h16-20H,1,5-14H2,2-4H3;1H4;1H |
| InChIKey | HYJREAFWDMEFAX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|