C17H20N2O3S2 — CID 14516895
2-(4,7-dimethyl-3a,5,6,7a-tetrahydro-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-5-(furan-2-yl)cyclohexane-1,3-dione (PubChem CID 14516895) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-(4,7-dimethyl-3a,5,6,7a-tetrahydro-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-5-(furan-2-yl)cyclohexane-1,3-dione.
| Compound Name | 2-(4,7-dimethyl-3a,5,6,7a-tetrahydro-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-5-(furan-2-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 14516895 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-(4,7-dimethyl-3a,5,6,7a-tetrahydro-[1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-5-(furan-2-yl)cyclohexane-1,3-dione |
| SMILES | CN1CCN(C)C2SC(=C3C(=O)CC(c4ccco4)CC3=O)SC21 |
| InChI | InChI=1S/C17H20N2O3S2/c1-18-5-6-19(2)16-15(18)23-17(24-16)14-11(20)8-10(9-12(14)21)13-4-3-7-22-13/h3-4,7,10,15-16H,5-6,8-9H2,1-2H3 |
| InChIKey | YJSSWCFFWUEVBE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|