C25H40N+ — CID 145169163
[(2E,4E,6E,11E,12Z)-3,9-bis(ethenyl)-11-ethylidene-10-methyltetradeca-2,4,6,12-tetraenylidene]-dimethylazanium;ethane (PubChem CID 145169163) has the molecular formula C25H40N+ and a molecular weight of 354.60 g/mol. Its IUPAC name is [(2E,4E,6E,11E,12Z)-3,9-bis(ethenyl)-11-ethylidene-10-methyltetradeca-2,4,6,12-tetraenylidene]-dimethylazanium;ethane.
| Compound Name | [(2E,4E,6E,11E,12Z)-3,9-bis(ethenyl)-11-ethylidene-10-methyltetradeca-2,4,6,12-tetraenylidene]-dimethylazanium;ethane |
|---|---|
| PubChem CID | 145169163 |
| Molecular Formula | C25H40N+ |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | [(2E,4E,6E,11E,12Z)-3,9-bis(ethenyl)-11-ethylidene-10-methyltetradeca-2,4,6,12-tetraenylidene]-dimethylazanium;ethane |
| SMILES | C=CC(/C=C/C=C/CC(C=C)C(C)C(/C=C\C)=C/C)=C\C=[N+](C)C.CC |
| InChI | InChI=1S/C23H34N.C2H6/c1-8-15-22(10-3)20(5)23(11-4)17-14-12-13-16-21(9-2)18-19-24(6)7;1-2/h8-16,18-20,23H,2,4,17H2,1,3,5-7H3;1-2H3/q+1;/b14-12+,15-8-,16-13+,21-18+,22-10+; |
| InChIKey | TVWMGVRTTYAJTF-RXGDDAIOSA-N |
| XLogP | 6.93 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|